Sodium malonate, CAS 141-95-7
Sodium malonate is a water-soluble, organic sodium salt formed between sodium and malonic acid. In biochemical and microbiology applications, sodium malonate is mostly used as cryoprotectant for isolating, purifying, and crystallizing biomolecules such as proteins, DNA, enzymes, etc. In other applications, sodium malonate is useful as a polymer cross-linking agent, preservative, electrolyte, fire retardant, chelator; corrosion inhibitor, etc.
Tech Specs
Appearance: white crystalline powder
CAS: 141-95-7
Purity: 99%+
Formula: C3H2Na2O4
MW: 148.03g/mol
Solubility: water soluble (145-150g/L)
Ph: 7.0-9.0 (10wt% aqueous solution)
HS Code: 291719
MDL: MFCD00002708
SMILES: [Na+].[Na+].[O-]C(=O)CC([O-])=O
Synonyms
malonic acid disodium salt; propanedioic acid, disodium salt; sodium malonate dibasic; disodium propanedioate
Tags
malonate; metal malonate; dicarboxylate; disodium salt; sodium malonate; disodium salt; chelator; biochemical reagent; electrolyte; fire retardant